美国3P种子下载

  • <tr id='5g6sOO'><strong id='5g6sOO'></strong><small id='5g6sOO'></small><button id='5g6sOO'></button><li id='5g6sOO'><noscript id='5g6sOO'><big id='5g6sOO'></big><dt id='5g6sOO'></dt></noscript></li></tr><ol id='5g6sOO'><option id='5g6sOO'><table id='5g6sOO'><blockquote id='5g6sOO'><tbody id='5g6sOO'></tbody></blockquote></table></option></ol><u id='5g6sOO'></u><kbd id='5g6sOO'><kbd id='5g6sOO'></kbd></kbd>

    <code id='5g6sOO'><strong id='5g6sOO'></strong></code>

    <fieldset id='5g6sOO'></fieldset>
          <span id='5g6sOO'></span>

              <ins id='5g6sOO'></ins>
              <acronym id='5g6sOO'><em id='5g6sOO'></em><td id='5g6sOO'><div id='5g6sOO'></div></td></acronym><address id='5g6sOO'><big id='5g6sOO'><big id='5g6sOO'></big><legend id='5g6sOO'></legend></big></address>

              <i id='5g6sOO'><div id='5g6sOO'><ins id='5g6sOO'></ins></div></i>
              <i id='5g6sOO'></i>
            1. <dl id='5g6sOO'></dl>
              1. <blockquote id='5g6sOO'><q id='5g6sOO'><noscript id='5g6sOO'></noscript><dt id='5g6sOO'></dt></q></blockquote><noframes id='5g6sOO'><i id='5g6sOO'></i>

                美国3P种子下载

              2. <tr id='5g6sOO'><strong id='5g6sOO'></strong><small id='5g6sOO'></small><button id='5g6sOO'></button><li id='5g6sOO'><noscript id='5g6sOO'><big id='5g6sOO'></big><dt id='5g6sOO'></dt></noscript></li></tr><ol id='5g6sOO'><option id='5g6sOO'><table id='5g6sOO'><blockquote id='5g6sOO'><tbody id='5g6sOO'></tbody></blockquote></table></option></ol><u id='5g6sOO'></u><kbd id='5g6sOO'><kbd id='5g6sOO'></kbd></kbd>

                <code id='5g6sOO'><strong id='5g6sOO'></strong></code>

                <fieldset id='5g6sOO'></fieldset>
                      <span id='5g6sOO'></span>

                          <ins id='5g6sOO'></ins>
                          <acronym id='5g6sOO'><em id='5g6sOO'></em><td id='5g6sOO'><div id='5g6sOO'></div></td></acronym><address id='5g6sOO'><big id='5g6sOO'><big id='5g6sOO'></big><legend id='5g6sOO'></legend></big></address>

                          <i id='5g6sOO'><div id='5g6sOO'><ins id='5g6sOO'></ins></div></i>
                          <i id='5g6sOO'></i>
                        1. <dl id='5g6sOO'></dl>
                          1. <blockquote id='5g6sOO'><q id='5g6sOO'><noscript id='5g6sOO'></noscript><dt id='5g6sOO'></dt></q></blockquote><noframes id='5g6sOO'><i id='5g6sOO'></i>
                             
                                     Chlorhexidine dihydrochlor...
                                     Chlorhexidine acetate
                                     Chlorhexidine digluconate
                                     P-Chloroaniline hydrochlor...
                                     1,6-hexanediamine dihydroc...
                                     1,3-Acetonedicarboxylic ac...
                                     Dimethyl 1,3-acetonedicarb...
                                     Diethyl 1,3-acetonedicarbo...
                                     Hydriodic acid
                                     Hydroxyethyl urea
                                     More Products
                             
                              >> Products

                            【Product name】 Chlorhexidine dihydrochloride
                            【CAS NO.】 3697-42-5
                            【Content】 Molecular weight: 578.37
                            EC NO: 223-026-6
                            Molecular formula: C22H30CI2N10.2HCl
                            Properties:White or white-like crystal powder.
                            Melting point:255~259℃
                            Content: C22H30CI2N10.2HCl(drying)≥ 98 %
                            Appearance:It is odorless and bitter white or nearly white crystal powder.
                            4-Chloroaniline ≤ 0.05%
                            Residue on ignition ≤ 0.1%
                            Loss on drying ≤ 1%
                            Quality specification:QVR(or BP2002/EP5.2)
                            Storage:Cool, dry, sealed.
                            Alias: Chlorhexidine hydrochloride
                            Structural formula:





                            Copyright(C)2012,Shanxi Weinan Juyuan Chemical Technology Co.,Ltd.  Supported by ChemNet ChinaChemNet Toocle Copyright Notice sitemap